130312-01-5 Usage
Uses
Used in Organic Synthesis:
(TETRAHYDRO-PYRAN-4-YLIDENE)-ACETIC ACID is used as a synthetic intermediate for the preparation of various organic compounds. Its unique structure allows it to serve as a building block in the synthesis of complex organic molecules, contributing to the development of new chemical entities.
Used in Pharmaceutical Research:
In the pharmaceutical industry, (TETRAHYDRO-PYRAN-4-YLIDENE)-ACETIC ACID is used as a potential candidate for drug discovery and development. Its distinctive chemical properties may enable the design and synthesis of novel therapeutic agents, targeting specific biological pathways or receptors.
Used in Chemical Research:
(TETRAHYDRO-PYRAN-4-YLIDENE)-ACETIC ACID is utilized as a subject of study in chemical research to explore its reactivity, stability, and potential interactions with other molecules. This research can provide valuable insights into the compound's behavior and its suitability for various applications.
Used in Material Science:
(TETRAHYDRO-PYRAN-4-YLIDENE)-ACETIC ACID may also find applications in material science, where its unique structure could be leveraged to develop new materials with specific properties, such as improved stability, reactivity, or selectivity in chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 130312-01-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,3,1 and 2 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 130312-01:
(8*1)+(7*3)+(6*0)+(5*3)+(4*1)+(3*2)+(2*0)+(1*1)=55
55 % 10 = 5
So 130312-01-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H10O3/c8-7(9)5-6-1-3-10-4-2-6/h5H,1-4H2,(H,8,9)
