13040-89-6 Usage
General Description
Pyrimidine, 4-amino-5-chloro-6-methyl- (7CI,8CI) is a chemical compound with the molecular formula C6H6ClN3. It is a derivative of the heterocyclic compound pyrimidine, which is found in DNA and RNA. This particular derivative contains an amino group, a chlorine atom, and a methyl group attached to the pyrimidine ring. It is used in the synthesis of various pharmaceuticals and agrochemicals, and it may also have potential applications in the field of medicinal chemistry. Additionally, it has been studied for its potential biological activities, such as anticancer and antimicrobial properties, making it an important compound for research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 13040-89-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,0,4 and 0 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13040-89:
(7*1)+(6*3)+(5*0)+(4*4)+(3*0)+(2*8)+(1*9)=66
66 % 10 = 6
So 13040-89-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H6ClN3/c1-3-4(6)5(7)9-2-8-3/h2H,1H3,(H2,7,8,9)