13040-89-6 Usage
Uses
Used in Pharmaceutical Industry:
Pyrimidine, 4-amino-5-chloro-6-methyl(7CI,8CI) is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure allows it to be a building block for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
Pyrimidine, 4-amino-5-chloro-6-methyl(7CI,8CI) is also utilized in the synthesis of agrochemicals, contributing to the development of new pesticides or herbicides that can improve agricultural productivity and crop protection.
Used in Medicinal Chemistry Research:
Pyrimidine, 4-amino-5-chloro-6-methyl(7CI,8CI) is employed as a subject of study in medicinal chemistry for its potential biological activities. Research is focused on exploring its properties to understand its interactions with biological systems and its potential as a therapeutic agent.
Used in Anticancer Research:
Pyrimidine, 4-amino-5-chloro-6-methyl(7CI,8CI) has been studied for its potential anticancer properties, making it a significant candidate for research and development within the pharmaceutical industry. Its specific structural features may contribute to the inhibition of cancer cell growth or the disruption of cancer-related pathways.
Used in Antimicrobial Research:
Pyrimidine, 4-amino-5-chloro-6-methyl(7CI,8CI) is also being investigated for its antimicrobial potential, which could lead to the development of new antibiotics or antifungal agents to combat drug-resistant infections.
Check Digit Verification of cas no
The CAS Registry Mumber 13040-89-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,0,4 and 0 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13040-89:
(7*1)+(6*3)+(5*0)+(4*4)+(3*0)+(2*8)+(1*9)=66
66 % 10 = 6
So 13040-89-6 is a valid CAS Registry Number.
InChI:InChI=1/C5H6ClN3/c1-3-4(6)5(7)9-2-8-3/h2H,1H3,(H2,7,8,9)
