130403-95-1 Usage
Pyrrolidine derivative
A derivative of pyrrolidine This means that 1-N-Cbz-3-Methoxy-pyrrolidine is based on the pyrrolidine structure, with modifications made to it.
3-Methoxy substitution
A methoxy group (-OCH3) is attached to the third carbon of the pyrrolidine ring This substitution introduces an electron-donating group to the compound, affecting its reactivity and properties.
Carboxybenzyl (Cbz) protecting group
A Cbz group is attached to the nitrogen atom This protecting group masks the nitrogen atom, allowing for selective reactions to occur at other sites on the molecule.
Potential use in organic synthesis
1-N-Cbz-3-Methoxy-pyrrolidine can be used as a building block or intermediate in the synthesis of more complex organic compounds This makes it a valuable tool in the creation of new chemical entities.
Pharmaceutical research applications
The compound may have potential applications in the development of new drug molecules This highlights the importance of studying 1-N-Cbz-3-Methoxy-pyrrolidine for its potential therapeutic uses.
Selective manipulation of the nitrogen atom
The presence of the Cbz protecting group allows for selective reactions at the nitrogen atom This feature is crucial for the synthesis of complex molecules, as it enables chemists to control the reactivity of the nitrogen atom.
Check Digit Verification of cas no
The CAS Registry Mumber 130403-95-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,4,0 and 3 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 130403-95:
(8*1)+(7*3)+(6*0)+(5*4)+(4*0)+(3*3)+(2*9)+(1*5)=81
81 % 10 = 1
So 130403-95-1 is a valid CAS Registry Number.
InChI:InChI=1S/C13H17NO3/c1-16-12-7-8-14(9-12)13(15)17-10-11-5-3-2-4-6-11/h2-6,12H,7-10H2,1H3
