130423-83-5 Usage
Uses
Used in Pharmaceutical Industry:
5-(2-Phenyleth-1-ynyl)-2-furoic acid is used as a synthetic chemical for the development of new pharmaceutical compounds. Its unique molecular structure may offer potential applications in the synthesis of drugs with specific therapeutic properties.
Used in Agrochemical Industry:
5-(2-Phenyleth-1-ynyl)-2-furoic acid is used as a synthetic chemical in the agrochemical industry for the development of new agrochemical products. Its potential reactivity with other substances may contribute to the creation of novel agrochemicals with improved efficacy and selectivity.
Used in Materials Science:
5-(2-Phenyleth-1-ynyl)-2-furoic acid is used as a synthetic chemical in materials science for the development of new materials with specific properties. Its molecular structure may contribute to the creation of innovative materials with applications in various fields, such as electronics, coatings, and adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 130423-83-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,4,2 and 3 respectively; the second part has 2 digits, 8 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 130423-83:
(8*1)+(7*3)+(6*0)+(5*4)+(4*2)+(3*3)+(2*8)+(1*3)=85
85 % 10 = 5
So 130423-83-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H8O3/c14-13(15)12-9-8-11(16-12)7-6-10-4-2-1-3-5-10/h1-5,8-9H,(H,14,15)
