130423-85-7 Usage
Uses
Used in Organic Synthesis:
METHYL 5-(2-PHENYLETH-1-YNYL)-2-FUROATE is used as a building block in organic synthesis for the creation of various complex organic molecules. Its unique structure allows it to be a versatile component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Materials Science:
In the field of materials science, METHYL 5-(2-PHENYLETH-1-YNYL)-2-FUROATE is utilized as a precursor for the development of novel materials with specific properties. Its incorporation into polymers or other materials can lead to advancements in areas such as electronics, coatings, and composites, where its structural features contribute to enhanced performance.
Check Digit Verification of cas no
The CAS Registry Mumber 130423-85-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,4,2 and 3 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 130423-85:
(8*1)+(7*3)+(6*0)+(5*4)+(4*2)+(3*3)+(2*8)+(1*5)=87
87 % 10 = 7
So 130423-85-7 is a valid CAS Registry Number.
InChI:InChI=1/C14H10O3/c1-16-14(15)13-10-9-12(17-13)8-7-11-5-3-2-4-6-11/h2-6,9-10H,1H3
