13053-61-7 Usage
General Description
Z-HIS-PHE-PHE-OET is a peptide derivative consisting of four amino acids - histidine, phenylalanine, phenylalanine, and ethyl ester. This chemical compound has the potential to exhibit a variety of biological activities due to the specific sequence of amino acids in its structure. Histidine is known for its role in enzyme catalysis, metal binding, and protein structure stabilization, while phenylalanine is a precursor for neurotransmitters and plays a key role in protein structure and function. The ethyl ester group at the end of the peptide chain may impact the compound's solubility and bioavailability. Overall, Z-HIS-PHE-PHE-OET has the potential to be utilized in various research and pharmaceutical applications due to its unique chemical composition.
Check Digit Verification of cas no
The CAS Registry Mumber 13053-61-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,0,5 and 3 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13053-61:
(7*1)+(6*3)+(5*0)+(4*5)+(3*3)+(2*6)+(1*1)=67
67 % 10 = 7
So 13053-61-7 is a valid CAS Registry Number.
InChI:InChI=1/C34H37N5O6/c1-2-44-33(42)30(19-25-14-8-4-9-15-25)38-31(40)28(18-24-12-6-3-7-13-24)37-32(41)29(20-27-21-35-23-36-27)39-34(43)45-22-26-16-10-5-11-17-26/h3-17,21,23,28-30H,2,18-20,22H2,1H3,(H,35,36)(H,37,41)(H,38,40)(H,39,43)