13053-63-9 Usage
General Description
Z-HIS-TYR-TYR-OET is a peptide chemical compound consisting of the amino acid sequence histidine-tyrosine-tyrosine with an ethyl ester group attached to the C-terminus. Histidine, tyrosine, and tyrosine are natural amino acids commonly found in proteins and play important roles in various biological processes. The ethyl ester group is a common functional group used to modify peptides for various applications. Z-HIS-TYR-TYR-OET may have potential applications in research, drug development, and medical therapies due to its specific sequence and functional group modifications. This chemical compound can be synthesized and used to study the structure and function of proteins, design novel drugs, and explore potential therapeutic applications in medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 13053-63-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,0,5 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13053-63:
(7*1)+(6*3)+(5*0)+(4*5)+(3*3)+(2*6)+(1*3)=69
69 % 10 = 9
So 13053-63-9 is a valid CAS Registry Number.
InChI:InChI=1/C34H37N5O8/c1-2-46-33(44)30(17-23-10-14-27(41)15-11-23)38-31(42)28(16-22-8-12-26(40)13-9-22)37-32(43)29(18-25-19-35-21-36-25)39-34(45)47-20-24-6-4-3-5-7-24/h3-15,19,21,28-30,40-41H,2,16-18,20H2,1H3,(H,35,36)(H,37,43)(H,38,42)(H,39,45)