130691-47-3Relevant academic research and scientific papers
The 1,4- and 2,3-diazadiene complexes of carbonylvanadium. Their 51V NMR properties, and the crystal structure of cis-5-C5Me5V(CO)2iPrN=CHCH=NiPr>
Woitha, Claus,Behrens, Ulrich,Vergopoulos, Vassilios,Rehder, Dieter
, p. 97 - 109 (1990)
The reaction between Cp'V(CO)3THF (Cp' = C5H5, C5H4SiMe3, C5Me5) or and diazadienes (RN=CHCH=NR (dad), R'HC=NN=CHR' (azine); L) at low temperature yields the complexes cis- (R = n-C5H11, iPr, tBu, Ph, 4-
