13070-53-6 Usage
Uses
Used in Pharmaceutical Industry:
Ethyl 3-(ethylamino)crotonate is used as a raw material for the synthesis of various pharmaceuticals. It plays a crucial role in the production of several active ingredients in medications due to its unique chemical structure and reactivity.
Used in Agrochemical Industry:
Ethyl 3-(ethylamino)crotonate is also utilized in the agrochemical sector, where it serves as a starting material for the synthesis of various agrochemicals, contributing to the development of effective pest control agents and other agricultural products.
Used in Flavor and Fragrance Industry:
Ethyl 3-(ethylamino)crotonate is used as a component in the flavor and fragrance industry, capitalizing on its fruity odor to create or enhance the scent profiles of various products, such as perfumes, cosmetics, and food flavorings.
Check Digit Verification of cas no
The CAS Registry Mumber 13070-53-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,0,7 and 0 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13070-53:
(7*1)+(6*3)+(5*0)+(4*7)+(3*0)+(2*5)+(1*3)=66
66 % 10 = 6
So 13070-53-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H15NO2/c1-4-9-7(3)6-8(10)11-5-2/h6,9H,4-5H2,1-3H3/b7-6-
