130707-32-3 Usage
General Description
2-amino-4-[(4-chlorophenyl)amino]pyridine-3-carbonitrile is a chemical compound with the molecular formula C13H9ClN4. It is a pyridine derivative containing an amino group, a chlorine-substituted phenyl group, and a cyano group. 2-amino-4-[(4-chlorophenyl)amino]pyridine-3-carbonitrile is often used in the synthesis of pharmaceutical products and agrochemicals. Its unique chemical structure makes it potentially useful in the development of new drugs and pesticides. However, due to its complex molecular structure and potential reactivity, it requires careful handling and close adherence to safety protocols in laboratory settings.
Check Digit Verification of cas no
The CAS Registry Mumber 130707-32-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,7,0 and 7 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 130707-32:
(8*1)+(7*3)+(6*0)+(5*7)+(4*0)+(3*7)+(2*3)+(1*2)=93
93 % 10 = 3
So 130707-32-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H9ClN4/c13-8-1-3-9(4-2-8)17-11-5-6-16-12(15)10(11)7-14/h1-6H,(H3,15,16,17)
