130870-00-7 Usage
General Description
4-Bromo-2,5-dimethylphenylboronic acid is a chemical compound with the molecular formula C8H10BBrO2. It is a boronic acid derivative widely used in organic synthesis and has specific relevance in the field of pharmaceuticals. It acts as an important intermediate and building block in the synthesis of more complex chemical compounds. Despite its significant potential for reactivity, it is generally stable under typical storage conditions. However, like most boronic acids, it can undergo oxidation in air, and should therefore be handled and stored appropriately. Its bromine and boron elements and the tethered boronic acid group provide numerous opportunities for molecular coupling reactions, making this compound an essential tool in medicinal chemistry research.
Check Digit Verification of cas no
The CAS Registry Mumber 130870-00-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,8,7 and 0 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 130870-00:
(8*1)+(7*3)+(6*0)+(5*8)+(4*7)+(3*0)+(2*0)+(1*0)=97
97 % 10 = 7
So 130870-00-7 is a valid CAS Registry Number.
InChI:InChI=1/C8H10BBrO2/c1-5-4-8(10)6(2)3-7(5)9(11)12/h3-4,11-12H,1-2H3
