1309-55-3 Usage
General Description
Manganese oxide is a chemical compound that consists of manganese and oxygen atoms. It is a black or dark brown solid that is commonly used as an inorganic pigment in various applications, including the production of ceramics, glass, and dyes. Manganese oxide is also used as a component in batteries and as a catalyst in chemical reactions. It has the ability to improve the mechanical strength and resistance to corrosion of various materials, making it a valuable additive in the manufacturing industry. Additionally, manganese oxide has potential applications in the field of environmental remediation, particularly for the removal of heavy metals from water and soil. Overall, manganese oxide plays a critical role in various industrial and environmental processes due to its unique properties and versatility.
Check Digit Verification of cas no
The CAS Registry Mumber 1309-55-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,3,0 and 9 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1309-55:
(6*1)+(5*3)+(4*0)+(3*9)+(2*5)+(1*5)=63
63 % 10 = 3
So 1309-55-3 is a valid CAS Registry Number.
InChI:InChI=1/3Mn.4O/rMn3O4/c1-4-2-6-3(5-1)7-2