130992-20-0 Usage
Uses
1. Used in Research Applications:
Acetic acid, oxo(1,3,4-thiadiazol-2-ylamino)(9CI) is used as a research chemical for studying its properties and potential applications in various fields. Acetic acid, oxo(1,3,4-thiadiazol-2-ylamino) (9CI)'s unique structure and organosulfur content make it an interesting subject for scientific investigation.
2. Used in Industrial Applications:
In the industrial sector, Acetic acid, oxo(1,3,4-thiadiazol-2-ylamino)(9CI) may be used as an intermediate in the synthesis of other compounds or as a component in the production of certain materials. Its specific role in these processes would depend on its reactivity and compatibility with other substances.
3. Used in Patent Applications:
Acetic acid, oxo(1,3,4-thiadiazol-2-ylamino)(9CI) may be mentioned in patent applications as a novel compound with potential uses in various industries. The patent could detail its synthesis, properties, and potential applications, providing a foundation for future research and development in the field.
Check Digit Verification of cas no
The CAS Registry Mumber 130992-20-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,0,9,9 and 2 respectively; the second part has 2 digits, 2 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 130992-20:
(8*1)+(7*3)+(6*0)+(5*9)+(4*9)+(3*2)+(2*2)+(1*0)=120
120 % 10 = 0
So 130992-20-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H3N3O3S/c8-2(3(9)10)6-4-7-5-1-11-4/h1H,(H,9,10)(H,6,7,8)
