1310384-34-9 Usage
General Description
(5-Aminopyridin-3-yl)boronic acid hydrochloride is a chemical compound containing an aminopyridine ring and a boronic acid group, with a hydrochloride salt. It is commonly used in organic synthesis and medicinal chemistry as a building block for the synthesis of various biologically active compounds. (5-AMinopyridin-3-yl)boronic acid hydrochloride is known for its ability to form stable complexes with cis-diol-containing molecules, making it a valuable tool in the development of new pharmaceuticals and bioconjugates. Additionally, it has been studied for its potential use in the treatment of various diseases such as cancer, diabetes, and infectious diseases. The hydrochloride salt form of this compound provides better solubility and stability in aqueous solution, making it easier to handle and use in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 1310384-34-9 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,3,1,0,3,8 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1310384-34:
(9*1)+(8*3)+(7*1)+(6*0)+(5*3)+(4*8)+(3*4)+(2*3)+(1*4)=109
109 % 10 = 9
So 1310384-34-9 is a valid CAS Registry Number.
InChI:InChI=1S/C5H7BN2O2.ClH/c7-5-1-4(6(9)10)2-8-3-5;/h1-3,9-10H,7H2;1H
