1310404-02-4 Usage
Description
Benzo[c]isothiazol-5-ylboronic acid is a chemical compound characterized by a benzoisothiazole ring with a boronic acid functional group attached to it. It is recognized for its unique structure and reactivity, making it a significant compound in the realms of chemistry and pharmaceuticals. This versatile reagent is known for its ability to participate in a range of reactions, including the Suzuki-Miyaura cross-coupling, which is instrumental in the synthesis of complex molecules. Its applications extend to organic synthesis and medicinal chemistry, where it serves as a building block for the preparation of various pharmaceutical compounds. Boronic acids, including Benzo[c]isothiazol-5-ylboronic acid, are renowned for their capacity to form stable complexes with diols, which is pivotal in the development of novel drug candidates and agrochemicals.
Uses
Used in Organic Synthesis:
Benzo[c]isothiazol-5-ylboronic acid is used as a building block for the synthesis of complex organic molecules. Its ability to participate in various reactions, such as the Suzuki-Miyaura cross-coupling, makes it a valuable tool in this field.
Used in Medicinal Chemistry:
In the domain of medicinal chemistry, Benzo[c]isothiazol-5-ylboronic acid is utilized as a key component in the preparation of pharmaceutical compounds. Its unique structure and reactivity contribute to the development of novel drug candidates.
Used in Drug Development:
Benzo[c]isothiazol-5-ylboronic acid is employed as a reagent in the development of new drugs. Its capacity to form stable complexes with diols is crucial for creating effective and innovative pharmaceuticals.
Used in Agrochemical Development:
Benzo[c]isothiazol-5-ylboronic acid is also used in the agrochemical industry for the development of novel agrochemicals, leveraging its ability to form stable complexes with diols to enhance the performance of agricultural products.
Overall, Benzo[c]isothiazol-5-ylboronic acid's multifaceted applications across different industries underscore its importance as a research and development tool in chemistry and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 1310404-02-4 includes 10 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 7 digits, 1,3,1,0,4,0 and 4 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1310404-02:
(9*1)+(8*3)+(7*1)+(6*0)+(5*4)+(4*0)+(3*4)+(2*0)+(1*2)=74
74 % 10 = 4
So 1310404-02-4 is a valid CAS Registry Number.
InChI:InChI=1S/C7H6BNO2S/c10-8(11)6-1-2-7-5(3-6)4-12-9-7/h1-4,10-11H