131052-62-5 Usage
Uses
Used in Chemical Reactions and Synthetic Processes:
2(1H)-Pyridinone,6-(aminomethyl)-(9CI) is utilized as a key intermediate in various chemical reactions and synthetic processes. Its unique structure allows it to participate in a range of reactions, making it a valuable component in the synthesis of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2(1H)-Pyridinone,6-(aminomethyl)-(9CI) is used as a building block for the development of new drugs. Its presence in the molecular structure can impart specific biological activities, contributing to the therapeutic effects of the final drug product.
Used in Agrochemical Industry:
2(1H)-Pyridinone,6-(aminomethyl)-(9CI) also finds application in the agrochemical industry, where it serves as a precursor for the synthesis of various agrochemicals. Its incorporation into these compounds can enhance their effectiveness in pest control and crop protection.
Used in Material Development:
Furthermore, 2(1H)-Pyridinone,6-(aminomethyl)-(9CI) has potential applications in the development of new materials. Its versatile nature allows it to be incorporated into the design of materials with unique properties, such as improved stability, reactivity, or selectivity.
Check Digit Verification of cas no
The CAS Registry Mumber 131052-62-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,0,5 and 2 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 131052-62:
(8*1)+(7*3)+(6*1)+(5*0)+(4*5)+(3*2)+(2*6)+(1*2)=75
75 % 10 = 5
So 131052-62-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O/c7-4-5-2-1-3-6(9)8-5/h1-3H,4,7H2,(H,8,9)
