13130-43-3 Usage
Uses
Used in Pharmaceutical Industry:
2-ACETYLAMINO-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID is used as a key intermediate in the synthesis of various pharmaceuticals for its ability to contribute to the development of novel compounds with potential therapeutic benefits. Its unique structure and functional groups allow for the creation of new drugs with improved efficacy and selectivity.
Used in Agrochemical Industry:
In the agrochemical sector, 2-ACETYLAMINO-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID is utilized as a precursor in the production of agrochemicals, such as pesticides and herbicides. Its chemical versatility facilitates the design of effective compounds targeting specific pests or weeds, thereby enhancing crop protection and yield.
Used in Medicinal Chemistry Research:
2-ACETYLAMINO-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID serves as a valuable tool in medicinal chemistry research, where it is employed for exploring its potential biological activities. Researchers use 2-ACETYLAMINO-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID to investigate its interactions with biological targets, which may lead to the discovery of new drugs with significant therapeutic potential.
Used in Drug Development:
In the realm of drug development, 2-ACETYLAMINO-4,5,6,7-TETRAHYDRO-BENZO[B]THIOPHENE-3-CARBOXYLIC ACID is leveraged as a building block for designing and optimizing drug candidates. Its diverse chemical properties allow for the fine-tuning of pharmacokinetic and pharmacodynamic properties, resulting in the development of more effective and safer medications.
Check Digit Verification of cas no
The CAS Registry Mumber 13130-43-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,1,3 and 0 respectively; the second part has 2 digits, 4 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13130-43:
(7*1)+(6*3)+(5*1)+(4*3)+(3*0)+(2*4)+(1*3)=53
53 % 10 = 3
So 13130-43-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H13NO3S/c1-6(13)12-10-9(11(14)15)7-4-2-3-5-8(7)16-10/h2-5H2,1H3,(H,12,13)(H,14,15)
