131379-40-3 Usage
Uses
Used in Organic Synthesis:
2-(Ethoxycarbonyl)phenylzinc Bromide is used as a reagent in the formation of new carbon-carbon bonds, which is crucial for the synthesis of complex organic molecules. Its high reactivity allows for the creation of a wide range of compounds, making it a versatile tool in the field of organic chemistry.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-(Ethoxycarbonyl)phenylzinc Bromide is used as a key intermediate in the synthesis of various drug molecules. Its ability to form new carbon-carbon bonds enables the creation of complex molecular structures that can be tailored for specific therapeutic applications.
Used in Material Science:
2-(Ethoxycarbonyl)phenylzinc Bromide is employed in the development of new materials with unique properties. Its role in forming carbon-carbon bonds can lead to the creation of novel polymers, plastics, and other materials with potential applications in various industries, such as electronics, automotive, and aerospace.
Used in Research and Development:
In academic and industrial research settings, 2-(Ethoxycarbonyl)phenylzinc Bromide is used as a starting material for exploring new reaction pathways and developing innovative synthetic methods. Its reactivity and versatility make it an essential component in the pursuit of new discoveries and advancements in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 131379-40-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,3,7 and 9 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 131379-40:
(8*1)+(7*3)+(6*1)+(5*3)+(4*7)+(3*9)+(2*4)+(1*0)=113
113 % 10 = 3
So 131379-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H9O2.BrH.Zn/c1-2-11-9(10)8-6-4-3-5-7-8;;/h3-6H,2H2,1H3;1H;/q;;+1/p-1/rC9H9BrO2Zn/c1-2-12-9(11)7-5-3-4-6-8(7)13-10/h3-6H,2H2,1H3
