13153-32-7 Usage
Main Properties
1. Chemical compound
2. Belongs to the group of ribonucleosides
3. Modified nucleoside
4. Contains a purine base with an amino group and an iodine atom attached to the sixth carbon
5. Potential applications in medicinal chemistry and drug development
6. Unique structure and properties
7. Valuable tool for studying nucleoside metabolism
Specific Content
2-AMINO-6-IODOPURINE RIBONUCLEOSIDE is a chemical compound belonging to the group of ribonucleosides.
It is a modified nucleoside containing a purine base with an amino group and an iodine atom attached to the sixth carbon.
This compound has potential applications in medicinal chemistry and drug development, particularly in the synthesis of nucleoside analogs for antiviral and antitumor agents.
Its unique structure and properties make it a valuable tool for studying nucleoside metabolism and understanding the role of modified nucleosides in biological systems.
2-AMINO-6-IODOPURINE RIBONUCLEOSIDE has also been investigated for its potential as a therapeutic agent for various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 13153-32-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,1,5 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 13153-32:
(7*1)+(6*3)+(5*1)+(4*5)+(3*3)+(2*3)+(1*2)=67
67 % 10 = 7
So 13153-32-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H12IN5O4/c11-7-4-8(15-10(12)14-7)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h2-3,5-6,9,17-19H,1H2,(H2,12,14,15)
