1316-92-3 Usage
Uses
Used in Catalysis:
Acetylruthenocene is used as a catalyst in various chemical reactions due to its unique reactivity and stability. It facilitates the conversion of reactants to products, improving the efficiency and selectivity of the reactions.
Used in Organic Synthesis:
As a building block in organic synthesis, acetylruthenocene is used to construct complex organic molecules. Its unique structure allows for the formation of new chemical bonds and the synthesis of novel compounds with potential applications in various fields.
Used in Materials and Chemical Research:
Acetylruthenocene's electrochemical and photophysical properties make it a valuable candidate for research in materials science and chemistry. It can be employed in the development of new materials with specific properties, such as conductivity, luminescence, or catalytic activity.
Used in Industrial Applications:
The potential industrial applications of acetylruthenocene include its use in the production of pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique reactivity and properties can contribute to the development of new processes and products in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1316-92-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,3,1 and 6 respectively; the second part has 2 digits, 9 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 1316-92:
(6*1)+(5*3)+(4*1)+(3*6)+(2*9)+(1*2)=63
63 % 10 = 3
So 1316-92-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H8O.C5H5.Ru/c1-6(8)7-4-2-3-5-7;1-2-4-5-3-1;/h2-5,8H,1H3;1-5H;/q;-1;+2/p-1
