13174-93-1 Usage
Uses
Used in Organic Synthesis:
1-(2-Pyridinyl)benzotriazole is used as a synthetic building block for the creation of a diverse range of organic compounds. Its presence in the synthesis process contributes to the formation of complex molecular structures, which can be further utilized in various applications across different industries.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1-(2-Pyridinyl)benzotriazole is used as a key intermediate in the development of new drugs. Its unique chemical properties allow for the creation of novel drug candidates with potential therapeutic benefits.
Used in Chemical Research:
1-(2-Pyridinyl)benzotriazole is also employed in chemical research as a valuable tool for understanding various reaction mechanisms and exploring new synthetic pathways. Its use in research contributes to the advancement of knowledge in the field of chemistry and the development of innovative chemical processes.
Used in Material Science:
In the field of material science, 1-(2-Pyridinyl)benzotriazole is used as a component in the development of new materials with specific properties. Its incorporation into the material's structure can lead to the creation of materials with enhanced characteristics, such as improved stability, reactivity, or selectivity.
Overall, 1-(2-Pyridinyl)benzotriazole is a versatile compound with a wide range of applications across various industries, including organic synthesis, pharmaceuticals, chemical research, and material science. Its unique properties and potential for use in the development of new compounds and materials make it an essential component in the field of chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 13174-93-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,1,7 and 4 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13174-93:
(7*1)+(6*3)+(5*1)+(4*7)+(3*4)+(2*9)+(1*3)=91
91 % 10 = 1
So 13174-93-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H8N4/c1-2-6-10-9(5-1)13-14-15(10)11-7-3-4-8-12-11/h1-8H
