131864-67-0 Usage
Uses
Used in Chemical Industry:
(R,R)-2,2'-(2,6-PYRIDINEDIYL)BIS(4-ISOPROPYL-2-OXAZOLINE) is used as a C2 symmetric ligand for enantioselective catalysis. Its strong affinity for various metals allows it to easily form bidentate coordination complexes, making it a valuable tool in the synthesis of chiral compounds.
Used in Pharmaceutical Industry:
(R,R)-2,2'-(2,6-PYRIDINEDIYL)BIS(4-ISOPROPYL-2-OXAZOLINE) is used as a chiral ligand in the development of enantioselective catalysts for the synthesis of pharmaceutical compounds. Its ability to form bidentate coordination complexes with various metals makes it a useful tool in creating chiral centers in drug molecules, which can improve the efficacy and selectivity of these compounds.
Reaction
Ligand for enantioselective nitrone cycloaddition to α,β-unsaturated 2-acyl imidazoles.
Highly efficient catalytic enantioselective Mannich reaction of malonates with N-tert-butoxycarbonyl imines.
Check Digit Verification of cas no
The CAS Registry Mumber 131864-67-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,1,8,6 and 4 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 131864-67:
(8*1)+(7*3)+(6*1)+(5*8)+(4*6)+(3*4)+(2*6)+(1*7)=130
130 % 10 = 0
So 131864-67-0 is a valid CAS Registry Number.
InChI:InChI=1/C17H23N3O2/c1-10(2)14-8-21-16(19-14)12-6-5-7-13(18-12)17-20-15(9-22-17)11(3)4/h5-7,10-11,14-15H,8-9H2,1-4H3/t14-,15-/m0/s1
