1320-15-6 Usage
Uses
Used in Agriculture:
2,4-DB-2-ETHYLHEXYL ESTER is used as a post-emergent herbicide for controlling broadleaf weeds in various crops such as soybeans, peanuts, and cotton. It is effective in managing unwanted plant growth that can compete with the desired crops for nutrients, sunlight, and space, thus improving crop yield and quality.
However, it is crucial to handle and apply 2,4-DB-2-ETHYLHEXYL ESTER with caution due to its potential harmful effects if ingested, inhaled, or absorbed through the skin. Additionally, it has the potential to be harmful to aquatic organisms and may persist in the environment, necessitating responsible use and proper disposal to minimize environmental impact.
Check Digit Verification of cas no
The CAS Registry Mumber 1320-15-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,3,2 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 1320-15:
(6*1)+(5*3)+(4*2)+(3*0)+(2*1)+(1*5)=36
36 % 10 = 6
So 1320-15-6 is a valid CAS Registry Number.
InChI:InChI=1/C18H26Cl2O3/c1-14(2)7-4-3-5-11-23-18(21)8-6-12-22-17-10-9-15(19)13-16(17)20/h9-10,13-14H,3-8,11-12H2,1-2H3
