132063-03-7 Usage
Description
2-ACETAMIDO-4,6-O-BENZYLIDENE-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE is an off-white solid that serves as a key intermediate in the synthesis of various biologically active compounds. It is particularly known for its role in the production of 2-acetamido-2-deoxy-D-gluconohydroximolactone (PUGNAc), a potent inhibitor of β-N-acetylglucosaminidases.
Uses
Used in Pharmaceutical Industry:
2-ACETAMIDO-4,6-O-BENZYLIDENE-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE is used as a synthetic intermediate for the production of PUGNAc, a strong inhibitor of β-N-acetylglucosaminidases. This application is significant due to the enzyme's involvement in various biological processes, making it a potential target for therapeutic intervention in conditions related to enzyme dysregulation.
Used in Chemical Synthesis:
As a versatile chemical intermediate, 2-ACETAMIDO-4,6-O-BENZYLIDENE-2-DEOXY-D-GLUCONHYDROXIMO-1,5-LACTONE can be utilized in the synthesis of other complex molecules and compounds, contributing to the development of novel pharmaceuticals, agrochemicals, and other specialty chemicals. Its unique structure and reactivity make it a valuable building block in organic chemistry and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 132063-03-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,0,6 and 3 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 132063-03:
(8*1)+(7*3)+(6*2)+(5*0)+(4*6)+(3*3)+(2*0)+(1*3)=77
77 % 10 = 7
So 132063-03-7 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2O6/c1-8(18)16-11-12(19)13-10(22-14(11)17-20)7-21-15(23-13)9-5-3-2-4-6-9/h2-6,10-13,15,19-20H,7H2,1H3,(H,16,18)/t10?,11?,12?,13-,15?/m1/s1