13207-55-1 Usage
Uses
Used in Organic Chemistry:
4-(2,6-Dichlorophenyl)-3-thiosemicarbazide is used as a precursor in the synthesis of various organic compounds due to its unique reactivity. It serves as a key intermediate, facilitating the creation of a wide array of chemical products.
Used in Pharmaceutical Synthesis:
4-(2,6-DICHLOROPHENYL)-3-THIOSEMICARBAZIDE is utilized as a building block in the development of potential pharmaceuticals. Its role in the synthesis process is crucial for the creation of new drug candidates, which may eventually lead to the discovery of novel treatments and therapies.
Used in Research and Development:
In the context of research and development, 4-(2,6-Dichlorophenyl)-3-thiosemicarbazide is employed as a tool to explore new chemical reactions and pathways. Its unique structure allows scientists to investigate its properties and potential applications in-depth, contributing to the advancement of chemical knowledge and technology.
Check Digit Verification of cas no
The CAS Registry Mumber 13207-55-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,2,0 and 7 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 13207-55:
(7*1)+(6*3)+(5*2)+(4*0)+(3*7)+(2*5)+(1*5)=71
71 % 10 = 1
So 13207-55-1 is a valid CAS Registry Number.
InChI:InChI=1/C7H7Cl2N3S/c8-4-2-1-3-5(9)6(4)11-7(13)12-10/h1-3H,10H2,(H2,11,12,13)
13207-55-1Relevant academic research and scientific papers
Anthelmintic 2 arylhydrazino and 2 arylazo 2 thiazolines
Wu,Waksmunski,Hoff,Fisher,Egerton,Patchett
, p. 1150 - 1153 (2007/10/05)
Some 2 arylhydrazino and 2 arylazo 2 thiazolines were synthesized for anthelmintic testing. The most potent compound, 2 (o tolylazo) 2 thiazoline, was orally effective in sheep against a broad range of helminths.
