132089-37-3 Usage
Uses
Used in Medicinal Chemistry:
2-(3-FLUORO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a valuable component in the creation of new drugs with potential therapeutic benefits.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2-(3-FLUORO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER is used as a key building block in the development of novel drug candidates. Its incorporation into drug molecules can potentially enhance their efficacy, selectivity, and pharmacokinetic properties, leading to improved treatments for various diseases and conditions.
Used in Drug Synthesis:
2-(3-FLUORO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER is utilized as a starting material in the synthesis of a wide range of pharmaceutically relevant compounds. Its reactivity and structural features make it a versatile component in the design and preparation of new drugs with diverse mechanisms of action.
Used in Biological Research:
In biological research, 2-(3-FLUORO-PHENYL)-THIAZOLE-4-CARBOXYLIC ACID ETHYL ESTER serves as a tool compound for studying the interactions between small molecules and biological targets. Its potential biological activity allows researchers to investigate its effects on various cellular processes and pathways, contributing to a better understanding of disease mechanisms and the discovery of new therapeutic targets.
Check Digit Verification of cas no
The CAS Registry Mumber 132089-37-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,0,8 and 9 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 132089-37:
(8*1)+(7*3)+(6*2)+(5*0)+(4*8)+(3*9)+(2*3)+(1*7)=113
113 % 10 = 3
So 132089-37-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H10FNO2S/c1-2-16-12(15)10-7-17-11(14-10)8-4-3-5-9(13)6-8/h3-7H,2H2,1H3
