13210-25-8 Usage
General Description
1-(3-Amino-pyridin-2-yl)-ethanone, also known as CAS Number 14867-21-1, is a chemical compound from the pyridines category. It exhibits properties associated with the building blocks of many medicinal compounds, such as antibacterials, antifungals, and antivirals. The compound plays a significant role in chemistry for its potential therapeutic effects. However, it requires careful handling due to its potential hazards, such as being harmful if swallowed, causing skin irritation, and serious eye damage. The chemical has a molar mass of 136.16 g/mol and is commonly used in applications within pharmaceutical and organic synthesis.
Check Digit Verification of cas no
The CAS Registry Mumber 13210-25-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,2,1 and 0 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 13210-25:
(7*1)+(6*3)+(5*2)+(4*1)+(3*0)+(2*2)+(1*5)=48
48 % 10 = 8
So 13210-25-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H8N2O/c1-5(10)7-6(8)3-2-4-9-7/h2-4H,8H2,1H3
13210-25-8Relevant articles and documents
AROMATIC SULFONE COMPOUND AS ALDOSTERONE RECEPTOR MODULATOR
-
Page/Page column 29, (2010/11/28)
The present invention provides a compound represented by the following formula (I): [wherein, A represents a group of the following formula (A-1): etc., R1 and R2 each independently represent a hydrogen atom etc., Z represents CR3 etc., W represents CR4 etc., Q represents CR5 etc., R3, R4 and R5 each independently represent a hydrogen atom etc., Y represents an oxygen atom or sulfur atom, X represents an oxygen atom etc. and B represents an optionally substituted aryl group or optionally substituted heteroaryl group], the prodrug thereof or the pharmaceutically acceptable salt thereof for preventing or treating various diseases such as hypertesion, cerebral stroke, cardiac failure, etc.