1322-58-3 Usage
General Description
3,4,5,6-Tetrahydropseudoionone is a chemical compound that belongs to the class of tetrahydropyranones. It is commonly used in the fragrance industry due to its sweet, floral scent. 3,4,5,6-TETRAHYDROPSEUDOIONONE is known for its use in various perfumes, cosmetics, and household products. It is also used as a flavoring agent in food products. Additionally, 3,4,5,6-Tetrahydropseudoionone is being studied for its potential medicinal properties, including its ability to act as an anti-inflammatory and antioxidant agent. Overall, this chemical compound plays a significant role in the fragrance, flavor, and pharmaceutical industries.
Check Digit Verification of cas no
The CAS Registry Mumber 1322-58-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,3,2 and 2 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 1322-58:
(6*1)+(5*3)+(4*2)+(3*2)+(2*5)+(1*8)=53
53 % 10 = 3
So 1322-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C13H24O/c1-11(2)7-5-8-12(3)9-6-10-13(4)14/h6,10-12H,5,7-9H2,1-4H3
