1322-90-3 Usage
Physical state
Yellow crystalline solid
Type of compound
Aromatic ketone
Classification
Alpha, beta-unsaturated ketones
Applications
a. Organic synthesis
b. Medicinal chemistry (building block for pharmaceuticals and bioactive molecules)
c. Photochemistry (photosensitizer and photonic materials development)
Investigated properties
a. Antioxidant
b. Antibacterial
Industries
Versatile and valuable in various industries due to its multiple applications and properties
Check Digit Verification of cas no
The CAS Registry Mumber 1322-90-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,3,2 and 2 respectively; the second part has 2 digits, 9 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 1322-90:
(6*1)+(5*3)+(4*2)+(3*2)+(2*9)+(1*0)=53
53 % 10 = 3
So 1322-90-3 is a valid CAS Registry Number.
InChI:InChI=1/C16H14O/c1-13(17)16-9-5-8-15(12-16)11-10-14-6-3-2-4-7-14/h2-12H,1H3/b11-10-