132227-01-1 Usage
Uses
Used in Pharmaceutical Industry:
5-Benzofurancarbonitrile is used as a building block for the synthesis of various pharmaceuticals due to its unique structure and properties, which contribute to the development of bioactive molecules.
Used in Fine Chemicals Industry:
In the fine chemicals industry, 5-Benzofurancarbonitrile serves as a key intermediate, facilitating the production of specialty chemicals that require its specific structural attributes.
Used in Dye and Pigment Production:
5-Benzofurancarbonitrile is utilized in the creation of dyes and pigments, where its chemical composition plays a role in determining the color and stability of these products.
Used in Medicinal Chemistry Research:
5-Benzofurancarbonitrile has potential applications in medicinal chemistry, where it is explored for its capacity to be integrated into new drug discovery and development processes, given its unique structural features and reactivity.
Check Digit Verification of cas no
The CAS Registry Mumber 132227-01-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,2,2 and 7 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 132227-01:
(8*1)+(7*3)+(6*2)+(5*2)+(4*2)+(3*7)+(2*0)+(1*1)=81
81 % 10 = 1
So 132227-01-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H5NO/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5H
