132287-17-3 Usage
Uses
Used in Pharmaceutical Industry:
5-[2-(3,4-Dimethylphenyl)-2-phenylethyl]-1H-imidazole Hydrochloride is used as an intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to serve as a building block for the development of new drugs, particularly those targeting specific receptors or biological pathways.
Used in Chemical Synthesis:
In the field of organic chemistry, 5-[2-(3,4-Dimethylphenyl)-2-phenylethyl]-1H-imidazole Hydrochloride is used as a key component in the synthesis of complex organic molecules. Its versatility in reacting with other compounds makes it a valuable asset for creating a wide range of chemical products.
Used in Research and Development:
5-[2-(3,4-Dimethylphenyl)-2-phenylethyl]-1H-imidazole Hydrochloride is also utilized in research and development settings, where it can be employed to study the effects of various functional groups on the overall properties and reactivity of the molecule. This can lead to a better understanding of molecular interactions and the development of more effective drugs and chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 132287-17-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,2,8 and 7 respectively; the second part has 2 digits, 1 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 132287-17:
(8*1)+(7*3)+(6*2)+(5*2)+(4*8)+(3*7)+(2*1)+(1*7)=113
113 % 10 = 3
So 132287-17-3 is a valid CAS Registry Number.
InChI:InChI=1/C19H20N2.ClH/c1-14-8-9-17(10-15(14)2)19(11-18-12-20-13-21-18)16-6-4-3-5-7-16;/h3-10,12-13,19H,11H2,1-2H3,(H,20,21);1H
