13230-03-0 Usage
Uses
Used in Pharmaceutical Industry:
2-ethyl-4-nitro-1H-imidazole is utilized as an intermediate in the synthesis of a range of pharmaceuticals. Its antimicrobial and antifungal properties make it a valuable component in the development of drugs targeting microbial infections.
Used in Agricultural Industry:
In agriculture, 2-ethyl-4-nitro-1H-imidazole is employed as an intermediate for the production of pesticides. Its ability to control microbial growth is beneficial in protecting crops from diseases and pests, thereby enhancing crop yield and quality.
Used in Organic Chemistry:
2-ethyl-4-nitro-1H-imidazole also finds application in the field of organic chemistry, where it serves as a building block for the synthesis of more complex organic compounds. Its unique structure and functional groups make it a useful component in the creation of novel chemical entities with potential applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 13230-03-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,2,3 and 0 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13230-03:
(7*1)+(6*3)+(5*2)+(4*3)+(3*0)+(2*0)+(1*3)=50
50 % 10 = 0
So 13230-03-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H7N3O2/c1-2-4-6-3-5(7-4)8(9)10/h3H,2H2,1H3,(H,6,7)
