132406-95-2 Usage
General Description
The chemical "(4S,5R,6R)-5-acetamido-6-[(1S,2S)-3-(4-azido-2-nitro-3,5-ditritio-phen yl)sulfanyl-1,2-dihydroxy-propyl]-4-hydroxy-5,6-dihydro-4H-pyran-2-car boxylic acid" is a complex compound with multiple functional groups and stereochemistry. It contains an acetamido group, a hydroxy group, and a carboxylic acid group. It also includes a sulfanyl group attached to a 1,2-dihydroxy-propyl moiety. Additionally, the compound has a pyran ring structure with hydroxyl and acetamido substituents. Moreover, it features an azido and nitro group, and a ditritio-phenyl moiety. The compound's intricate structure and diverse functional groups suggest that it may have potential applications in pharmaceuticals or other industries.
Check Digit Verification of cas no
The CAS Registry Mumber 132406-95-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,4,0 and 6 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 132406-95:
(8*1)+(7*3)+(6*2)+(5*4)+(4*0)+(3*6)+(2*9)+(1*5)=102
102 % 10 = 2
So 132406-95-2 is a valid CAS Registry Number.
InChI:InChI=1/C17H19N5O9S/c1-7(23)19-14-10(24)5-12(17(27)28)31-16(14)15(26)11(25)6-32-13-3-2-8(20-21-18)4-9(13)22(29)30/h2-5,10-11,14-16,24-26H,6H2,1H3,(H,19,23)(H,27,28)/t10-,11+,14+,15+,16+/m0/s1/i2T,4T