132461-39-3 Usage
General Description
"(R)-1,2-Dithiolane-3-pentanoic acid polymer with 2-hydroxypropanoic acid" is a chemical compound that is formed by the polymerization of (R)-1,2-Dithiolane-3-pentanoic acid with 2-hydroxypropanoic acid. This polymer has potential applications in various industries, including pharmaceuticals, cosmetics, and food packaging. The compound is known for its versatility and ability to create strong and flexible materials, making it useful in creating biodegradable and environmentally friendly products. Additionally, the polymer has been studied for potential medical applications, such as in drug delivery systems. Overall, this compound holds promise for a wide range of applications due to its unique properties and potential benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 132461-39-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,4,6 and 1 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 132461-39:
(8*1)+(7*3)+(6*2)+(5*4)+(4*6)+(3*1)+(2*3)+(1*9)=103
103 % 10 = 3
So 132461-39-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O2S2.C3H6O3/c9-8(10)4-2-1-3-7-5-6-11-12-7;1-2(4)3(5)6/h7H,1-6H2,(H,9,10);2,4H,1H3,(H,5,6)/t7-;/m1./s1
