132461-42-8 Usage
Chemical compound
A substance formed as a result of DNA damage caused by exposure to environmental toxins or radiation.
Structural alteration
The modification can lead to changes in the structure and function of DNA.
Potential consequences
The changes in DNA structure can potentially lead to genetic mutations or cellular damage.
Biomarker
1,N(6)-propanodeoxyadenosine is considered a biomarker for DNA damage.
Role in carcinogenesis
It has been studied for its potential role in the development of cancer.
Aging-related diseases
The compound has also been studied for its potential role in aging-related diseases.
Mechanisms of DNA damage
Understanding the formation and consequences of this chemical modification can provide insights into the mechanisms of DNA damage.
Impact on human health
The study of 1,N(6)-propanodeoxyadenosine can help in understanding its impact on human health and the development of related diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 132461-42-8 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,4,6 and 1 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 132461-42:
(8*1)+(7*3)+(6*2)+(5*4)+(4*6)+(3*1)+(2*4)+(1*2)=98
98 % 10 = 8
So 132461-42-8 is a valid CAS Registry Number.
InChI:InChI=1/C13H17N5O4/c19-4-8-7(20)3-10(22-8)18-6-14-11-12(18)15-5-17-2-1-9(21)16-13(11)17/h5-10,19-21H,1-4H2/t7-,8+,9?,10+/m0/s1