132521-70-1 Usage
General Description
6-(4-Methylpiperazin-1-yl)nicotinic acid is a chemical compound that consists of a nicotinic acid molecule with a piperazine ring and a methyl group attached to it. It is commonly used in medicinal chemistry and drug development due to its potential therapeutic effects. The compound has been studied for its potential use in the treatment of various medical conditions, such as neurological disorders and psychiatric illnesses. It is also being investigated for its potential as a drug target for certain diseases. The chemical structure and properties of 6-(4-Methylpiperazin-1-yl)nicotinic acid make it a promising candidate for further research and development in the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 132521-70-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,5,2 and 1 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 132521-70:
(8*1)+(7*3)+(6*2)+(5*5)+(4*2)+(3*1)+(2*7)+(1*0)=91
91 % 10 = 1
So 132521-70-1 is a valid CAS Registry Number.
InChI:InChI=1/C11H15N3O2/c1-13-4-6-14(7-5-13)10-3-2-9(8-12-10)11(15)16/h2-3,8H,4-7H2,1H3,(H,15,16)