13253-82-2 Usage
Uses
Used in Pharmaceutical Industry:
[4-[(4-aminocyclohexyl)methyl]cyclohexyl]carbamic acid is used as a key intermediate in the synthesis of pharmaceuticals for its potential applications in treating various diseases, such as cancer. Its unique structure allows for the development of new drugs with specific therapeutic targets.
Used in Agrochemical Industry:
In the agrochemical sector, [4-[(4-aminocyclohexyl)methyl]cyclohexyl]carbamic acid is utilized as a building block in the creation of agrochemicals, leveraging its antifungal and antibacterial properties to protect crops and enhance agricultural productivity.
Check Digit Verification of cas no
The CAS Registry Mumber 13253-82-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,2,5 and 3 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 13253-82:
(7*1)+(6*3)+(5*2)+(4*5)+(3*3)+(2*8)+(1*2)=82
82 % 10 = 2
So 13253-82-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H26N2O2/c15-12-5-1-10(2-6-12)9-11-3-7-13(8-4-11)16-14(17)18/h10-13,16H,1-9,15H2,(H,17,18)
