13258-59-8 Usage
General Description
2-Ethyl-6-methyl-3-hydroxypyridine hydrochloride is a chemical compound with potential pharmaceutical applications. It is an organic compound that belongs to the pyridine family and is commonly used as an intermediate in the synthesis of various pharmaceuticals, pesticides, and other organic compounds. 2-ETHYL-6-METHYL-3-HYDROXYPYRIDINE HYDROCHLORIDE has a hydroxyl group, which gives it potential as a building block for drug synthesis. Additionally, the presence of the hydrochloride salt form increases the compound's solubility in water, making it easier to handle and formulate into pharmaceutical products. As such, 2-ethyl-6-methyl-3-hydroxypyridine hydrochloride has potential as a versatile and useful chemical for the pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 13258-59-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,2,5 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13258-59:
(7*1)+(6*3)+(5*2)+(4*5)+(3*8)+(2*5)+(1*9)=98
98 % 10 = 8
So 13258-59-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO.ClH/c1-3-7-8(10)5-4-6(2)9-7;/h4-5,10H,3H2,1-2H3;1H
