13258-59-8 Usage
Uses
Used in Pharmaceutical Industry:
2-Ethyl-6-methyl-3-hydroxypyridine hydrochloride is used as an intermediate in the synthesis of pharmaceuticals for its potential as a building block in drug development. The presence of the hydroxyl group allows for further chemical reactions and modifications, contributing to the creation of new and effective medications.
Used in Pesticide Industry:
In the pesticide industry, 2-ethyl-6-methyl-3-hydroxypyridine hydrochloride is utilized as an intermediate in the production of various pesticides. Its chemical properties make it suitable for the development of compounds that can effectively control and manage pests.
Used in Organic Compounds Synthesis:
2-Ethyl-6-methyl-3-hydroxypyridine hydrochloride is used as a versatile intermediate in the synthesis of other organic compounds. Its unique structure and functional groups enable the formation of a wide range of organic molecules for various applications, including chemical research and industrial processes.
Used in Solubility Enhancement:
The hydrochloride salt form of 2-ethyl-6-methyl-3-hydroxypyridine increases the compound's solubility in water, making it easier to handle and formulate into pharmaceutical products. This property is particularly useful in the development of water-soluble drug formulations, improving the compound's bioavailability and therapeutic effectiveness.
Check Digit Verification of cas no
The CAS Registry Mumber 13258-59-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,2,5 and 8 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 13258-59:
(7*1)+(6*3)+(5*2)+(4*5)+(3*8)+(2*5)+(1*9)=98
98 % 10 = 8
So 13258-59-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H11NO.ClH/c1-3-7-8(10)5-4-6(2)9-7;/h4-5,10H,3H2,1-2H3;1H
