132740-59-1 Usage
Description
2-(1-ISOPROPYL-PIPERIDIN-4-YL)-ETHYLAMINE, a chemical compound with the molecular formula C12H25N, is a derivative of piperidine featuring an isopropyl group attached to the piperidine ring. 2-(1-ISOPROPYL-PIPERIDIN-4-YL)-ETHYLAMINE is recognized for its versatility in organic synthesis, making it a valuable building block in the pharmaceutical and chemical industries for the production of a diverse array of products.
Uses
Used in Pharmaceutical Industry:
2-(1-ISOPROPYL-PIPERIDIN-4-YL)-ETHYLAMINE is used as a precursor in the synthesis of various pharmaceuticals for its ability to contribute to the development of new medicinal compounds. Its unique structure allows it to be a key component in creating molecules with specific therapeutic properties.
Used in Organic Synthesis:
In the field of organic synthesis, 2-(1-ISOPROPYL-PIPERIDIN-4-YL)-ETHYLAMINE is utilized as a reagent in chemical reactions, facilitating the formation of complex organic compounds. Its presence in these reactions often enhances the yield and selectivity of the desired products.
Used as an Intermediate in Chemical Production:
2-(1-ISOPROPYL-PIPERIDIN-4-YL)-ETHYLAMINE also serves as an intermediate in the production of various organic compounds, playing a crucial role in multi-step synthesis processes. Its stability and reactivity make it an ideal candidate for use in the creation of specialty chemicals and other advanced materials.
Check Digit Verification of cas no
The CAS Registry Mumber 132740-59-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,7,4 and 0 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 132740-59:
(8*1)+(7*3)+(6*2)+(5*7)+(4*4)+(3*0)+(2*5)+(1*9)=111
111 % 10 = 1
So 132740-59-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H22N2/c1-9(2)12-7-4-10(3-6-11)5-8-12/h9-10H,3-8,11H2,1-2H3
