132830-15-0 Usage
Molecular structure
The compound has a complex structure containing a carboxyl group, two oxidized phenyl groups, and an indium cation with a +3 charge.
Functional groups
The compound contains a carboxyl group (-COOH) and two amino groups (-NH2), which are responsible for its chemical reactivity.
Oxidized phenyl groups
The presence of two oxidized phenyl groups (-O-C6H4-O-) in the structure suggests that the compound may have unique electronic properties.
Indium cation
The presence of an indium cation (In3+) with a +3 charge suggests that the compound may have interesting coordination chemistry and could be used in various applications in inorganic chemistry.
Unique chemical and physical properties
The specific arrangement of atoms and functional groups in the structure may result in unique chemical and physical properties, making it of interest in fields such as materials science and pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 132830-15-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,8,3 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 132830-15:
(8*1)+(7*3)+(6*2)+(5*8)+(4*3)+(3*0)+(2*1)+(1*5)=100
100 % 10 = 0
So 132830-15-0 is a valid CAS Registry Number.
InChI:InChI=1/C18H20N2O6.In/c21-13-7-3-1-5-11(13)15(17(23)24)19-9-10-20-16(18(25)26)12-6-2-4-8-14(12)22;/h1-8,15-16,19-22H,9-10H2,(H,23,24)(H,25,26);/q;+3/p-4/i;1-4