132855-00-6 Usage
Description
2,6-Diacetyl-4-pyridinecarbonitrile is a versatile chemical compound with the molecular formula C9H7N3O2. It is a derivative of pyridine, featuring acetyl and cyano functional groups. 2,6-Diacetyl-4-pyridinecarbonitrile is known for its potential as a building block in the synthesis of pharmaceuticals and agrochemicals, as well as its use as a reactant in the preparation of heterocyclic compounds. Its structure and properties have garnered interest due to its various biological activities, including its potential as an anticancer and antimicrobial agent, making it a promising candidate for applications in the pharmaceutical and agricultural industries.
Uses
Used in Pharmaceutical Industry:
2,6-Diacetyl-4-pyridinecarbonitrile is used as a building block for the synthesis of various pharmaceuticals. Its unique structure and functional groups contribute to the development of new drugs with potential therapeutic applications.
Used in Agrochemical Industry:
2,6-Diacetyl-4-pyridinecarbonitrile is used as a building block in the synthesis of agrochemicals. Its potential as a reactant in the preparation of heterocyclic compounds makes it a valuable component in the development of new pesticides and other agricultural chemicals.
Used in Anticancer Applications:
2,6-Diacetyl-4-pyridinecarbonitrile is studied for its potential as an anticancer agent. Its biological activities suggest that it may have the ability to target and inhibit the growth of cancer cells, making it a promising candidate for further research and development in oncology.
Used in Antimicrobial Applications:
2,6-Diacetyl-4-pyridinecarbonitrile is also studied for its potential as an antimicrobial agent. Its ability to target and inhibit the growth of microorganisms, including bacteria and fungi, makes it a candidate for use in the development of new antimicrobial drugs and treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 132855-00-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,8,5 and 5 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 132855-00:
(8*1)+(7*3)+(6*2)+(5*8)+(4*5)+(3*5)+(2*0)+(1*0)=116
116 % 10 = 6
So 132855-00-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H8N2O2/c1-6(13)9-3-8(5-11)4-10(12-9)7(2)14/h3-4H,1-2H3
