132951-61-2 Usage
General Description
(4-fluorophenyl)-alpha-methyl-5-benzoxazole methylamine is a chemical compound that consists of a benzoxazole ring with a fluorophenyl and methylamine group attached to it. The 4-fluorophenyl group adds a fluorine atom to the phenyl ring, which can affect the compound's reactivity and properties. The alpha-methyl group is attached to the benzoxazole ring and can influence the compound's solubility and stability. Additionally, the presence of the methylamine group adds further complexity to the compound's chemical structure, potentially impacting its biological activity and interactions. This chemical compound may have potential applications in pharmaceuticals, materials science, or other industrial fields due to its distinct structure and properties.
Check Digit Verification of cas no
The CAS Registry Mumber 132951-61-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,2,9,5 and 1 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 132951-61:
(8*1)+(7*3)+(6*2)+(5*9)+(4*5)+(3*1)+(2*6)+(1*1)=122
122 % 10 = 2
So 132951-61-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H13FN2O/c1-2-17-12-7-8-14-13(9-12)18-15(19-14)10-3-5-11(16)6-4-10/h3-9,17H,2H2,1H3
