133047-44-6 Usage
Uses
Used in Pharmaceutical Industry:
4-Thiazolecarboxylic acid, 2-(1-methylethyl)-, ethyl ester (9CI) is used as a key intermediate in the synthesis of various pharmaceuticals for its potential to contribute to the development of new drugs. Its unique chemical structure allows it to be incorporated into a wide range of therapeutic agents, enhancing their efficacy and pharmacological properties.
Used in Agrochemical Industry:
In the agrochemical sector, 4-Thiazolecarboxylic acid, 2-(1-methylethyl)-, ethyl ester (9CI) serves as a crucial building block in the creation of novel agrochemicals. Its incorporation into these compounds can lead to the development of more effective and targeted pest control solutions, contributing to sustainable agricultural practices.
Used in Fine Chemicals Industry:
4-Thiazolecarboxylic acid, 2-(1-methylethyl)-, ethyl ester (9CI) is also utilized in the synthesis of fine chemicals, where its unique properties can be leveraged to create high-quality specialty chemicals for various applications. Its versatility makes it a valuable component in the development of innovative products in this industry.
Safety Precautions:
Due to its potential hazardous properties, 4-Thiazolecarboxylic acid, 2-(1-methylethyl)-, ethyl ester (9CI) should be handled and used with caution. Strict adherence to safety guidelines and regulations is essential to minimize risks associated with its use, ensuring the safety of both individuals and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 133047-44-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,3,0,4 and 7 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 133047-44:
(8*1)+(7*3)+(6*3)+(5*0)+(4*4)+(3*7)+(2*4)+(1*4)=96
96 % 10 = 6
So 133047-44-6 is a valid CAS Registry Number.
InChI:InChI=1/C9H13NO2S/c1-4-12-9(11)7-5-13-8(10-7)6(2)3/h5-6H,4H2,1-3H3
