133086-86-9 Usage
Functional Groups
Alkene, Alkyl Halide, Alkyl Chloride, Alkyl Bromide, and Methyl Group
Structural Features
A long carbon chain with multiple double bonds (alkene)
Presence of a bromine atom (alkyl bromide)
Presence of two chlorine atoms (alkyl chloride)
Presence of a methyl group (alkyl group)
A chloromethyl group attached to the seventh carbon atom
Physical State
Likely a liquid or solid at room temperature, due to the presence of multiple halogens which increase the molecular weight and boiling point
Polarity
Polar, due to the presence of electronegative halogen atoms and the asymmetrical structure of the molecule
Solubility
Likely soluble in organic solvents such as dichloromethane, acetone, or ethyl acetate, due to its nonpolar alkene and alkyl portions
Reactivity
Susceptible to nucleophilic substitution reactions, due to the presence of electronegative halogen atoms
May undergo electrophilic addition reactions, due to the presence of double bonds in the alkene
Potential Applications
Chemical synthesis as a precursor or reagent in organic reactions
Pesticide or herbicide development, due to the presence of multiple halogen atoms
Pharmaceutical research and development, with possible applications in medicinal chemistry
Further Research
The specific properties, applications, and potential hazards of this compound would need to be further explored and studied to determine its full potential and safety in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 133086-86-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,3,0,8 and 6 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 133086-86:
(8*1)+(7*3)+(6*3)+(5*0)+(4*8)+(3*6)+(2*8)+(1*6)=119
119 % 10 = 9
So 133086-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H10BrCl3/c1-7(6-11)2-3-8(12)9(13)4-5-10/h2-5,8-9H,1,6H2/b3-2+,5-4+/t8-,9-/m1/s1
