1332-94-1 Usage
General Description
Vitamins are a group of organic compounds that are essential for normal growth and nutrition. They are required in small amounts by the body and play various roles in metabolic processes and overall health. There are 13 essential vitamins, including A, C, D, E, K, and the B vitamins, each with specific functions in the body. Vitamins can be obtained through a well-balanced diet, but they can also be taken as supplements to ensure adequate intake. Deficiencies in vitamins can lead to various health problems, and excessive intake of certain vitamins can also be harmful. Overall, vitamins are crucial for maintaining good health and preventing illnesses.
Check Digit Verification of cas no
The CAS Registry Mumber 1332-94-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 1,3,3 and 2 respectively; the second part has 2 digits, 9 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 1332-94:
(6*1)+(5*3)+(4*3)+(3*2)+(2*9)+(1*4)=61
61 % 10 = 1
So 1332-94-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H15NO7/c15-6-8(7-4-2-1-3-5-7)21-14-11(18)9(16)10(17)12(22-14)13(19)20/h1-5,8-12,14,16-18H,(H,19,20)/t8-,9-,10-,11+,12-,14+/m0/s1
