13323-45-0 Usage
General Description
3-METHYL-3,9-DIAZASPIRO[5.5]UNDECANE is a chemical compound with the molecular formula C13H26N2. It is a spiro compound, which means it has a unique and complex three-dimensional structure. This chemical is commonly used in the pharmaceutical and agrochemical industries as a building block for the synthesis of various medicinal and agricultural products. Its spiro structure makes it useful for creating compounds with diverse biological activities. Additionally, it is utilized in the field of materials science for the development of novel materials with unique properties. Overall, 3-METHYL-3,9-DIAZASPIRO[5.5]UNDECANE has a wide range of applications and is an important compound in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 13323-45-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,2 and 3 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 13323-45:
(7*1)+(6*3)+(5*3)+(4*2)+(3*3)+(2*4)+(1*5)=70
70 % 10 = 0
So 13323-45-0 is a valid CAS Registry Number.
InChI:InChI=1/C10H20N2/c1-12-8-4-10(5-9-12)2-6-11-7-3-10/h11H,2-9H2,1H3
