133468-58-3 Usage
Uses
Used in Chemical Synthesis:
4-BROMOBENZENEBORONIC ACID N-METHYLDIETHANOLAMINE ESTER is used as a reagent for the selective reaction of the bromo substituent with organometallic derivatives, such as lithium. This selective reactivity is crucial in the synthesis of complex organic molecules and the formation of specific chemical bonds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-BROMOBENZENEBORONIC ACID N-METHYLDIETHANOLAMINE ESTER is used as an intermediate in the development of new drugs. Its unique reactivity with organometallic derivatives allows for the creation of novel molecular structures with potential therapeutic properties.
Used in Material Science:
4-BROMOBENZENEBORONIC ACID N-METHYLDIETHANOLAMINE ESTER can also be utilized in the field of material science, where its selective reactivity can be employed to create new materials with specific properties, such as improved conductivity or enhanced stability.
Check Digit Verification of cas no
The CAS Registry Mumber 133468-58-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 1,3,3,4,6 and 8 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 133468-58:
(8*1)+(7*3)+(6*3)+(5*4)+(4*6)+(3*8)+(2*5)+(1*8)=133
133 % 10 = 3
So 133468-58-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H15BBrNO2/c1-14-6-8-15-12(16-9-7-14)10-2-4-11(13)5-3-10/h2-5H,6-9H2,1H3
