13363-91-2 Usage
Uses
Used in Pharmaceutical Industry:
3-Isopropylcyclobutanecarboxylic acid is used as a key intermediate for the synthesis of various pharmaceuticals, contributing to the development of new drugs with improved therapeutic properties. Its ability to undergo functional group transformations and participate in cycloadditions allows for the creation of complex molecular structures with potential medicinal applications.
Used in Agrochemical Industry:
IPCB is used as a precursor in the synthesis of agrochemicals, such as pesticides and herbicides, to enhance crop protection and yield. Its versatility in organic chemistry enables the development of novel agrochemical compounds with increased efficacy and reduced environmental impact.
Used in Asymmetrical Syntheses:
3-Isopropylcyclobutanecarboxylic acid is used as a chiral auxiliary in asymmetrical syntheses, facilitating the production of enantiomerically pure compounds. This is crucial in the pharmaceutical industry, where the desired biological activity is often associated with a specific enantiomer, while the other enantiomer may be inactive or even harmful.
Used in Organic Chemistry Research:
IPCB is utilized as a versatile building block in organic chemistry research, enabling the exploration of new reaction pathways and the synthesis of complex organic compounds. Its ability to participate in various chemical reactions makes it an invaluable tool for advancing the field of organic chemistry and discovering new applications in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 13363-91-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,6 and 3 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 13363-91:
(7*1)+(6*3)+(5*3)+(4*6)+(3*3)+(2*9)+(1*1)=92
92 % 10 = 2
So 13363-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O2/c1-5(2)6-3-7(4-6)8(9)10/h5-7H,3-4H2,1-2H3,(H,9,10)
