13373-32-5 Usage
Uses
Used in Pharmaceutical Industry:
2-ISOPROPYL-4(5)-NITROIMIDAZOLE is used as a pharmaceutical compound for its mutagenic properties. It plays a significant role in the development of drugs targeting specific genetic mutations, potentially contributing to the treatment of various diseases and conditions.
Used in Research and Development:
In the field of research and development, 2-ISOPROPYL-4(5)-NITROIMIDAZOLE is utilized as a key compound in studying the effects of mutagenesis on cellular processes and genetic expressions. Its application aids in understanding the underlying mechanisms of genetic mutations and their implications on human health.
Used in Chemical Synthesis:
As a chemical intermediate, 2-ISOPROPYL-4(5)-NITROIMIDAZOLE is employed in the synthesis of various other compounds and materials. Its unique properties make it a valuable component in creating new chemical entities with potential applications in different industries.
Used in Material Science:
The pale yellow solid nature of 2-ISOPROPYL-4(5)-NITROIMIDAZOLE allows it to be used in material science for developing novel materials with specific properties. Its chemical structure can be manipulated to create materials with tailored characteristics for various applications, such as in electronics, coatings, or adhesives.
Check Digit Verification of cas no
The CAS Registry Mumber 13373-32-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,7 and 3 respectively; the second part has 2 digits, 3 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 13373-32:
(7*1)+(6*3)+(5*3)+(4*7)+(3*3)+(2*3)+(1*2)=85
85 % 10 = 5
So 13373-32-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H9N3O2/c1-4(2)6-7-3-5(8-6)9(10)11/h3-4H,1-2H3,(H,7,8)