13392-23-9 Usage
Main properties
1. Chemical compound
2. Pteridine derivative
3. Metabolism of amino acids
4. Production of neurotransmitters
5. Cofactor for enzymes
6. Synthesis of nitric oxide
7. Regulation of blood pressure and immune function
8. Synthesis of hormones
9. Detoxification of harmful substances
Specific content
1. Name: 2-amino-4-hydroxy-6-(1,2,3,4-tetrahydroxybutyl)pteridine
2. Also known as: Biopterin
3. Role: Crucial in various biological processes
4. Metabolism involvement: Metabolism of amino acids
5. Neurotransmitters involvement: Production of dopamine and serotonin
6. Enzyme involvement: Cofactor for several enzymes
7. Nitric oxide synthesis: Involved in the synthesis of nitric oxide
8. Blood pressure and immune function: Important for regulating blood pressure and immune function
9. Hormones synthesis: Essential for the synthesis of certain hormones
10. Detoxification involvement: Detoxification of harmful substances
11. Importance: Vital molecule for overall health and well-being.
Check Digit Verification of cas no
The CAS Registry Mumber 13392-23-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 1,3,3,9 and 2 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 13392-23:
(7*1)+(6*3)+(5*3)+(4*9)+(3*2)+(2*2)+(1*3)=89
89 % 10 = 9
So 13392-23-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N5O5/c11-10-14-8-5(9(20)15-10)13-3(1-12-8)6(18)7(19)4(17)2-16/h1,4,6-7,16-19H,2H2,(H3,11,12,14,15,20)
